C10H15NO5 — CID 171346458
(1R,2S,3R,7S,9S)-2-hydroxy-5,5-dimethyl-4,6,10-trioxa-12-azatricyclo[7.3.0.03,7]dodecan-11-one (PubChem CID 171346458) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (1R,2S,3R,7S,9S)-2-hydroxy-5,5-dimethyl-4,6,10-trioxa-12-azatricyclo[7.3.0.03,7]dodecan-11-one.
| Compound Name | (1R,2S,3R,7S,9S)-2-hydroxy-5,5-dimethyl-4,6,10-trioxa-12-azatricyclo[7.3.0.03,7]dodecan-11-one |
|---|---|
| PubChem CID | 171346458 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1R,2S,3R,7S,9S)-2-hydroxy-5,5-dimethyl-4,6,10-trioxa-12-azatricyclo[7.3.0.03,7]dodecan-11-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)[C@H]3NC(=O)O[C@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C10H15NO5/c1-10(2)15-5-3-4-6(11-9(13)14-4)7(12)8(5)16-10/h4-8,12H,3H2,1-2H3,(H,11,13)/t4-,5-,6-,7-,8-/m0/s1 |
| InChIKey | VGKKIDVQXUFYEJ-WXUMCUSRSA-N |
| XLogP | -0.25 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |