C26H33N7O3S — CID 171346473
1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(2-piperidin-1-ylsulfonylanilino)ethanone (PubChem CID 171346473) has the molecular formula C26H33N7O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(2-piperidin-1-ylsulfonylanilino)ethanone.
| Compound Name | 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(2-piperidin-1-ylsulfonylanilino)ethanone |
|---|---|
| PubChem CID | 171346473 |
| Molecular Formula | C26H33N7O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(2-piperidin-1-ylsulfonylanilino)ethanone |
| SMILES | O=C(CNc1ccccc1S(=O)(=O)N1CCCCC1)N1CC[C@H]2CCN(c3ncnc4[nH]ccc34)[C@H]2C1 |
| InChI | InChI=1S/C26H33N7O3S/c34-24(16-28-21-6-2-3-7-23(21)37(35,36)32-12-4-1-5-13-32)31-14-9-19-10-15-33(22(19)17-31)26-20-8-11-27-25(20)29-18-30-26/h2-3,6-8,11,18-19,22,28H,1,4-5,9-10,12-17H2,(H,27,29,30)/t19-,22-/m0/s1 |
| InChIKey | XMOLCISGFGUQQW-UGKGYDQZSA-N |
| XLogP | 2.67 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |