C33H51N3O2 — CID 171346570
(1R,2S,5S,10S,14R,15R,23R)-19-(2-aminoethyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17,20-triene-5-carboxylic acid (PubChem CID 171346570) has the molecular formula C33H51N3O2 and a molecular weight of 521.79 g/mol. Its IUPAC name is (1R,2S,5S,10S,14R,15R,23R)-19-(2-aminoethyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17,20-triene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,10S,14R,15R,23R)-19-(2-aminoethyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17,20-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 171346570 |
| Molecular Formula | C33H51N3O2 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | (1R,2S,5S,10S,14R,15R,23R)-19-(2-aminoethyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17,20-triene-5-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cn(CCN)nc6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C33H51N3O2/c1-28(2)12-14-33(27(37)38)15-13-31(6)22(23(33)19-28)8-9-25-30(5)18-21-20-36(17-16-34)35-26(21)29(3,4)24(30)10-11-32(25,31)7/h8,20,23-25H,9-19,34H2,1-7H3,(H,37,38)/t23-,24-,25+,30-,31+,32+,33-/m0/s1 |
| InChIKey | DGHGMDHXNILOHS-CEJXBKOESA-N |
| XLogP | 6.74 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|