C30H48O7Si — CID 171346690
[(1R,2R,4aS,5R,8aS)-5-[2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 171346690) has the molecular formula C30H48O7Si and a molecular weight of 548.79 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8aS)-5-[2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [(1R,2R,4aS,5R,8aS)-5-[2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 171346690 |
| Molecular Formula | C30H48O7Si |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | [(1R,2R,4aS,5R,8aS)-5-[2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)CC[C@@]2(C)[C@@H]1CC(OC(C)=O)C1=CCOC1=O |
| InChI | InChI=1S/C30H48O7Si/c1-19-11-12-25-29(7,23(19)17-24(36-20(2)31)22-14-16-34-27(22)33)15-13-26(37-21(3)32)30(25,8)18-35-38(9,10)28(4,5)6/h14,23-26H,1,11-13,15-18H2,2-10H3/t23-,24?,25+,26-,29+,30+/m1/s1 |
| InChIKey | KFDOFDJXZMIOJU-DUTVQBKCSA-N |
| XLogP | 6.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|