About 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one
3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one (PubChem CID 171346775) has the molecular formula C23H19N3O2S
and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one.
Molecular Properties
| Compound Name | 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one |
| PubChem CID | 171346775 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one |
| SMILES | Cc1ccc2c(c1)nc(CCc1coc3ccccc3c1=O)n2Cc1cncs1 |
| InChI | InChI=1S/C23H19N3O2S/c1-15-6-8-20-19(10-15)25-22(26(20)12-17-11-24-14-29-17)9-7-16-13-28-21-5-3-2-4-18(21)23(16)27/h2-6,8,10-11,13-14H,7,9,12H2,1H3 |
| InChIKey | LRYQEKHDUJKIBO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one?
The IUPAC name of 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one (CID 171346775) is 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one.
What is the SMILES notation for 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one?
The canonical SMILES for 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one is Cc1ccc2c(c1)nc(CCc1coc3ccccc3c1=O)n2Cc1cncs1.
What is the InChIKey of 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one?
The InChIKey is LRYQEKHDUJKIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O2S/c1-15-6-8-20-19(10-15)25-22(26(20)12-17-11-24-14-29-17)9-7-16-13-28-21-5-3-2-4-18(21)23(16)27/h2-6,8,10-11,13-14H,7,9,12H2,1H3.
What are the key properties of 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one?
3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one has a molecular weight of 401.49 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[5-methyl-1-(1,3-thiazol-5-ylmethyl)benzimidazol-2-yl]ethyl]chromen-4-one is sourced from PubChem (CID 171346775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).