C16H16N2O7 — CID 171347016
5-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 171347016) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 171347016 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | COc1cc(C2CC(=O)Oc3[nH]c(=O)[nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C16H16N2O7/c1-22-9-4-7(5-10(23-2)13(9)24-3)8-6-11(19)25-15-12(8)14(20)17-16(21)18-15/h4-5,8H,6H2,1-3H3,(H2,17,18,20,21) |
| InChIKey | KXGPURYXLGRMEN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |