About 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol
2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol (PubChem CID 171347162) has the molecular formula C23H34O4
and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol.
Molecular Properties
| Compound Name | 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol |
| PubChem CID | 171347162 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol |
| SMILES | COc1cc(C)c(O)c2c1C=CC(C)(CC/C=C(\C)CCCC(C)(C)O)O2 |
| InChI | InChI=1S/C23H34O4/c1-16(9-7-12-22(3,4)25)10-8-13-23(5)14-11-18-19(26-6)15-17(2)20(24)21(18)27-23/h10-11,14-15,24-25H,7-9,12-13H2,1-6H3/b16-10+ |
| InChIKey | FCMMQSOZMWFQLS-MHWRWJLKSA-N |
| XLogP | 5.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol?
The IUPAC name of 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol (CID 171347162) is 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol.
What is the SMILES notation for 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol?
The canonical SMILES for 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol is COc1cc(C)c(O)c2c1C=CC(C)(CC/C=C(\C)CCCC(C)(C)O)O2.
What is the InChIKey of 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol?
The InChIKey is FCMMQSOZMWFQLS-MHWRWJLKSA-N. The full InChI is InChI=1S/C23H34O4/c1-16(9-7-12-22(3,4)25)10-8-13-23(5)14-11-18-19(26-6)15-17(2)20(24)21(18)27-23/h10-11,14-15,24-25H,7-9,12-13H2,1-6H3/b16-10+.
What are the key properties of 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol?
2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol has a molecular weight of 374.52 g/mol, XLogP of 5.54, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-8-hydroxy-4,8-dimethylnon-3-enyl]-5-methoxy-2,7-dimethylchromen-8-ol is sourced from PubChem (CID 171347162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).