About 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one
4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 171347218) has the molecular formula C27H23NO3
and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
| PubChem CID | 171347218 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC1(C(CC(=O)/C=C/c2ccccc2)c2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C27H23NO3/c1-27(26(30)31-25(28-27)22-15-9-4-10-16-22)24(21-13-7-3-8-14-21)19-23(29)18-17-20-11-5-2-6-12-20/h2-18,24H,19H2,1H3/b18-17+ |
| InChIKey | BMPFDLILMPIUOA-ISLYRVAYSA-N |
| XLogP | 5.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one?
The IUPAC name of 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one (CID 171347218) is 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one.
What is the SMILES notation for 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one?
The canonical SMILES for 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one is CC1(C(CC(=O)/C=C/c2ccccc2)c2ccccc2)N=C(c2ccccc2)OC1=O.
What is the InChIKey of 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one?
The InChIKey is BMPFDLILMPIUOA-ISLYRVAYSA-N. The full InChI is InChI=1S/C27H23NO3/c1-27(26(30)31-25(28-27)22-15-9-4-10-16-22)24(21-13-7-3-8-14-21)19-23(29)18-17-20-11-5-2-6-12-20/h2-18,24H,19H2,1H3/b18-17+.
What are the key properties of 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one?
4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one has a molecular weight of 409.49 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-[(E)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one is sourced from PubChem (CID 171347218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).