C22H32O3 — CID 171347264
(3R,5S,9S,10R,13S,14R,17S)-17-acetyl-3-hydroxy-5,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 171347264) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (3R,5S,9S,10R,13S,14R,17S)-17-acetyl-3-hydroxy-5,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (3R,5S,9S,10R,13S,14R,17S)-17-acetyl-3-hydroxy-5,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 171347264 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3R,5S,9S,10R,13S,14R,17S)-17-acetyl-3-hydroxy-5,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2C3=CC(=O)[C@@]4(C)C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H32O3/c1-13(23)16-5-6-17-15-11-19(25)22(4)12-14(24)7-10-21(22,3)18(15)8-9-20(16,17)2/h11,14,16-18,24H,5-10,12H2,1-4H3/t14-,16-,17+,18+,20-,21-,22-/m1/s1 |
| InChIKey | SFDLTPVAJIIMRO-MINJWGHFSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |