About 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride
2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride (PubChem CID 171347368) has the molecular formula C10H16ClNO2
and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride |
| PubChem CID | 171347368 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride |
| SMILES | CC(c1cc(O)ccc1O)N(C)C.Cl |
| InChI | InChI=1S/C10H15NO2.ClH/c1-7(11(2)3)9-6-8(12)4-5-10(9)13;/h4-7,12-13H,1-3H3;1H |
| InChIKey | AHLPMIGLEWZYFT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride?
The IUPAC name of 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride (CID 171347368) is 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride.
What is the SMILES notation for 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride?
The canonical SMILES for 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride is CC(c1cc(O)ccc1O)N(C)C.Cl.
What is the InChIKey of 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride?
The InChIKey is AHLPMIGLEWZYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2.ClH/c1-7(11(2)3)9-6-8(12)4-5-10(9)13;/h4-7,12-13H,1-3H3;1H.
What are the key properties of 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride?
2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride has a molecular weight of 217.70 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(dimethylamino)ethyl]benzene-1,4-diol;hydrochloride is sourced from PubChem (CID 171347368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).