C33H44O4 — CID 171347601
(1S,3R,4R,8S,10R,12R,14S)-12-benzoyl-4,7,7,8,16,16-hexamethyl-14-(3-methylbut-2-enyl)-6-oxatetracyclo[10.3.1.03,10.04,8]hexadecane-11,13-dione (PubChem CID 171347601) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is (1S,3R,4R,8S,10R,12R,14S)-12-benzoyl-4,7,7,8,16,16-hexamethyl-14-(3-methylbut-2-enyl)-6-oxatetracyclo[10.3.1.03,10.04,8]hexadecane-11,13-dione.
| Compound Name | (1S,3R,4R,8S,10R,12R,14S)-12-benzoyl-4,7,7,8,16,16-hexamethyl-14-(3-methylbut-2-enyl)-6-oxatetracyclo[10.3.1.03,10.04,8]hexadecane-11,13-dione |
|---|---|
| PubChem CID | 171347601 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | (1S,3R,4R,8S,10R,12R,14S)-12-benzoyl-4,7,7,8,16,16-hexamethyl-14-(3-methylbut-2-enyl)-6-oxatetracyclo[10.3.1.03,10.04,8]hexadecane-11,13-dione |
| SMILES | CC(C)=CC[C@H]1C[C@@H]2C[C@@H]3[C@@H](C[C@]4(C)C(C)(C)OC[C@]34C)C(=O)[C@](C(=O)c3ccccc3)(C1=O)C2(C)C |
| InChI | InChI=1S/C33H44O4/c1-20(2)14-15-22-16-23-17-25-24(18-32(8)30(5,6)37-19-31(25,32)7)28(36)33(27(22)35,29(23,3)4)26(34)21-12-10-9-11-13-21/h9-14,22-25H,15-19H2,1-8H3/t22-,23+,24+,25+,31+,32+,33-/m0/s1 |
| InChIKey | ANMSGGQOWGFCDT-PSBNPPRTSA-N |
| XLogP | 6.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|