About (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione
(3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione (PubChem CID 171347896) has the molecular formula C17H10FN3O2
and a molecular weight of 307.28 g/mol. Its IUPAC name is (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione.
Molecular Properties
| Compound Name | (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione |
| PubChem CID | 171347896 |
| Molecular Formula | C17H10FN3O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione |
| SMILES | O=c1[nH]n2c(=O)c3ccccc3nc2/c1=C/c1ccccc1F |
| InChI | InChI=1S/C17H10FN3O2/c18-13-7-3-1-5-10(13)9-12-15-19-14-8-4-2-6-11(14)17(23)21(15)20-16(12)22/h1-9H,(H,20,22)/b12-9- |
| InChIKey | QBEFEKVWQFUNGO-XFXZXTDPSA-N |
| XLogP | 1.22 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione?
The IUPAC name of (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione (CID 171347896) is (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione.
What is the SMILES notation for (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione?
The canonical SMILES for (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione is O=c1[nH]n2c(=O)c3ccccc3nc2/c1=C/c1ccccc1F.
What is the InChIKey of (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione?
The InChIKey is QBEFEKVWQFUNGO-XFXZXTDPSA-N. The full InChI is InChI=1S/C17H10FN3O2/c18-13-7-3-1-5-10(13)9-12-15-19-14-8-4-2-6-11(14)17(23)21(15)20-16(12)22/h1-9H,(H,20,22)/b12-9-.
What are the key properties of (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione?
(3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione has a molecular weight of 307.28 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2-fluorophenyl)methylidene]-1H-pyrazolo[5,1-b]quinazoline-2,9-dione is sourced from PubChem (CID 171347896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).