C20H16Cl2N4O2 — CID 171348051
4-chloro-3-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]chromen-2-one;hydrochloride (PubChem CID 171348051) has the molecular formula C20H16Cl2N4O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is 4-chloro-3-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]chromen-2-one;hydrochloride.
| Compound Name | 4-chloro-3-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 171348051 |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 4-chloro-3-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]chromen-2-one;hydrochloride |
| SMILES | Cl.O=c1oc2ccccc2c(Cl)c1-c1nc2ccc(C3=NCCCN3)cc2[nH]1 |
| InChI | InChI=1S/C20H15ClN4O2.ClH/c21-17-12-4-1-2-5-15(12)27-20(26)16(17)19-24-13-7-6-11(10-14(13)25-19)18-22-8-3-9-23-18;/h1-2,4-7,10H,3,8-9H2,(H,22,23)(H,24,25);1H |
| InChIKey | JDGYUPJHRMHESI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|