About 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline
2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline (PubChem CID 171348067) has the molecular formula C22H24FN3O4S
and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline.
Molecular Properties
| Compound Name | 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline |
| PubChem CID | 171348067 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline |
| SMILES | COc1ccc2nc(CN3CCN(S(=O)(=O)c4ccccc4F)CC3)cc(OC)c2c1 |
| InChI | InChI=1S/C22H24FN3O4S/c1-29-17-7-8-20-18(14-17)21(30-2)13-16(24-20)15-25-9-11-26(12-10-25)31(27,28)22-6-4-3-5-19(22)23/h3-8,13-14H,9-12,15H2,1-2H3 |
| InChIKey | POJLVBKMGUXKQO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline?
The IUPAC name of 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline (CID 171348067) is 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline.
What is the SMILES notation for 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline?
The canonical SMILES for 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline is COc1ccc2nc(CN3CCN(S(=O)(=O)c4ccccc4F)CC3)cc(OC)c2c1.
What is the InChIKey of 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline?
The InChIKey is POJLVBKMGUXKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FN3O4S/c1-29-17-7-8-20-18(14-17)21(30-2)13-16(24-20)15-25-9-11-26(12-10-25)31(27,28)22-6-4-3-5-19(22)23/h3-8,13-14H,9-12,15H2,1-2H3.
What are the key properties of 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline?
2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline has a molecular weight of 445.52 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4,6-dimethoxyquinoline is sourced from PubChem (CID 171348067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).