C32H34N2O2 — CID 171348097
(2R,5S)-2,5-bis[(4-phenylmethoxyphenyl)methyl]piperazine (PubChem CID 171348097) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is (2R,5S)-2,5-bis[(4-phenylmethoxyphenyl)methyl]piperazine.
| Compound Name | (2R,5S)-2,5-bis[(4-phenylmethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171348097 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2R,5S)-2,5-bis[(4-phenylmethoxyphenyl)methyl]piperazine |
| SMILES | c1ccc(COc2ccc(C[C@H]3CN[C@H](Cc4ccc(OCc5ccccc5)cc4)CN3)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O2/c1-3-7-27(8-4-1)23-35-31-15-11-25(12-16-31)19-29-21-34-30(22-33-29)20-26-13-17-32(18-14-26)36-24-28-9-5-2-6-10-28/h1-18,29-30,33-34H,19-24H2/t29-,30+ |
| InChIKey | XSWBEJKMNOIXIH-RNPORBBMSA-N |
| XLogP | 5.56 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |