C24H29NO4 — CID 171348159
(2R,3S,4S)-2-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-4-hydroxy-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one (PubChem CID 171348159) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2R,3S,4S)-2-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-4-hydroxy-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one.
| Compound Name | (2R,3S,4S)-2-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-4-hydroxy-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 171348159 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2R,3S,4S)-2-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-4-hydroxy-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
| SMILES | CC[C@H](C)/C=C(C)/C=C/[C@H]1Oc2c(-c3ccc(O)cc3)c[nH]c(=O)c2[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C24H29NO4/c1-5-14(2)12-15(3)6-11-20-16(4)22(27)21-23(29-20)19(13-25-24(21)28)17-7-9-18(26)10-8-17/h6-14,16,20,22,26-27H,5H2,1-4H3,(H,25,28)/b11-6+,15-12+/t14-,16+,20+,22-/m0/s1 |
| InChIKey | GDMBOEYTLRUBGV-LEDKIXFRSA-N |
| XLogP | 4.73 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|