C19H17NO — CID 171348203
15-methoxy-8,8-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 171348203) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 15-methoxy-8,8-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 15-methoxy-8,8-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 171348203 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 15-methoxy-8,8-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | COc1cc2c3c(nccc3c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C19H17NO/c1-19(2)16-7-5-4-6-14(16)15-11-13(21-3)10-12-8-9-20-18(19)17(12)15/h4-11H,1-3H3 |
| InChIKey | LTLITCBUKRVPRA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |