C18H19NOS2 — CID 171348217
3-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine (PubChem CID 171348217) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 3-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine.
| Compound Name | 3-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine |
|---|---|
| PubChem CID | 171348217 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine |
| SMILES | c1cncc(C2CCc3cc(C4SCCCS4)ccc3O2)c1 |
| InChI | InChI=1S/C18H19NOS2/c1-3-15(12-19-8-1)17-6-4-13-11-14(5-7-16(13)20-17)18-21-9-2-10-22-18/h1,3,5,7-8,11-12,17-18H,2,4,6,9-10H2 |
| InChIKey | IUJWCZCOYOLBBF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |