C22H25N5O2 — CID 171348368
6-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)oxymethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 171348368) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 6-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)oxymethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)oxymethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171348368 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 6-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)oxymethyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N)nc(COc3ccc4c(c3)CCC(C)(C)O4)n2)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-14-4-6-16(7-5-14)24-21-26-19(25-20(23)27-21)13-28-17-8-9-18-15(12-17)10-11-22(2,3)29-18/h4-9,12H,10-11,13H2,1-3H3,(H3,23,24,25,26,27) |
| InChIKey | QYEWHIXPEWHDHQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |