About 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide
4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide (PubChem CID 171348531) has the molecular formula C16H12Cl2INOS
and a molecular weight of 464.16 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide |
| PubChem CID | 171348531 |
| Molecular Formula | C16H12Cl2INOS |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 462.91 |
| IUPAC Name | 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide |
| SMILES | I.Nc1cc(-c2ccc(Oc3ccc(Cl)c(Cl)c3)cc2)cs1 |
| InChI | InChI=1S/C16H11Cl2NOS.HI/c17-14-6-5-13(8-15(14)18)20-12-3-1-10(2-4-12)11-7-16(19)21-9-11;/h1-9H,19H2;1H |
| InChIKey | QLBNVQPMAMFNLG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide?
The IUPAC name of 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide (CID 171348531) is 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide.
What is the SMILES notation for 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide?
The canonical SMILES for 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide is I.Nc1cc(-c2ccc(Oc3ccc(Cl)c(Cl)c3)cc2)cs1.
What is the InChIKey of 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide?
The InChIKey is QLBNVQPMAMFNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2NOS.HI/c17-14-6-5-13(8-15(14)18)20-12-3-1-10(2-4-12)11-7-16(19)21-9-11;/h1-9H,19H2;1H.
What are the key properties of 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide?
4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide has a molecular weight of 464.16 g/mol, XLogP of 6.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-dichlorophenoxy)phenyl]thiophen-2-amine;hydroiodide is sourced from PubChem (CID 171348531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).