C53H49N5O4 — CID 171348664
(5Z,9Z,14Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-2-piperidin-1-yl-1,20,22,24-tetrahydroporphyrin (PubChem CID 171348664) has the molecular formula C53H49N5O4 and a molecular weight of 820.01 g/mol. Its IUPAC name is (5Z,9Z,14Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-2-piperidin-1-yl-1,20,22,24-tetrahydroporphyrin.
| Compound Name | (5Z,9Z,14Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-2-piperidin-1-yl-1,20,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 171348664 |
| Molecular Formula | C53H49N5O4 |
| Molecular Weight | 820.01 g/mol |
| Exact Mass | 819.38 |
| IUPAC Name | (5Z,9Z,14Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-2-piperidin-1-yl-1,20,22,24-tetrahydroporphyrin |
| SMILES | COc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(OC)cc3)=c3/cc/c([nH]3)=C(\c3ccc(OC)cc3)C3=NC(C(N4CCCCC4)=C3)C(c3ccc(OC)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C53H49N5O4/c1-59-37-16-8-33(9-17-37)49-41-24-25-42(54-41)50(34-10-18-38(60-2)19-11-34)44-28-29-46(56-44)52(36-14-22-40(62-4)23-15-36)53-48(58-30-6-5-7-31-58)32-47(57-53)51(45-27-26-43(49)55-45)35-12-20-39(61-3)21-13-35/h8-29,32,52-53,55-56H,5-7,30-31H2,1-4H3/b49-43-,50-42-,51-45- |
| InChIKey | RAYYXFQCECNBDH-QGLLMTSCSA-N |
| XLogP | 8.58 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.01 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |