C18H11F6N5O — CID 171348736
(E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-3-pyrimidin-5-ylbut-3-en-2-one (PubChem CID 171348736) has the molecular formula C18H11F6N5O and a molecular weight of 427.31 g/mol. Its IUPAC name is (E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-3-pyrimidin-5-ylbut-3-en-2-one.
| Compound Name | (E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-3-pyrimidin-5-ylbut-3-en-2-one |
|---|---|
| PubChem CID | 171348736 |
| Molecular Formula | C18H11F6N5O |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-3-pyrimidin-5-ylbut-3-en-2-one |
| SMILES | CC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C18H11F6N5O/c1-10(30)15(12-5-25-8-26-6-12)7-29-9-27-16(28-29)11-2-13(17(19,20)21)4-14(3-11)18(22,23)24/h2-9H,1H3/b15-7- |
| InChIKey | ITZJCXBNMGPOGT-CHHVJCJISA-N |
| XLogP | 4.36 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|