C22H14Cl3N5OS2 — CID 171349327
5-[(4-chlorophenyl)diazenyl]-2-[3-(2,5-dichlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-ol (PubChem CID 171349327) has the molecular formula C22H14Cl3N5OS2 and a molecular weight of 534.88 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)diazenyl]-2-[3-(2,5-dichlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-ol.
| Compound Name | 5-[(4-chlorophenyl)diazenyl]-2-[3-(2,5-dichlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 171349327 |
| Molecular Formula | C22H14Cl3N5OS2 |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | 5-[(4-chlorophenyl)diazenyl]-2-[3-(2,5-dichlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-ol |
| SMILES | Oc1nc(N2N=C(c3cccs3)CC2c2cc(Cl)ccc2Cl)sc1/N=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl3N5OS2/c23-12-3-6-14(7-4-12)27-28-21-20(31)26-22(33-21)30-18(15-10-13(24)5-8-16(15)25)11-17(29-30)19-2-1-9-32-19/h1-10,18,31H,11H2/b28-27+ |
| InChIKey | XWXJPIIZHODTOZ-BYYHNAKLSA-N |
| XLogP | 8.64 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|