C35H48Cl4N4 — CID 171349334
(2Z)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-pentyl-2H-benzimidazol-2-yl)prop-2-enylidene]-5,6-dichloro-3-pentylbenzimidazole (PubChem CID 171349334) has the molecular formula C35H48Cl4N4 and a molecular weight of 666.61 g/mol. Its IUPAC name is (2Z)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-pentyl-2H-benzimidazol-2-yl)prop-2-enylidene]-5,6-dichloro-3-pentylbenzimidazole.
| Compound Name | (2Z)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-pentyl-2H-benzimidazol-2-yl)prop-2-enylidene]-5,6-dichloro-3-pentylbenzimidazole |
|---|---|
| PubChem CID | 171349334 |
| Molecular Formula | C35H48Cl4N4 |
| Molecular Weight | 666.61 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | (2Z)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-pentyl-2H-benzimidazol-2-yl)prop-2-enylidene]-5,6-dichloro-3-pentylbenzimidazole |
| SMILES | CCCCCN1/C(=C\C=C\C2N(CCCC)c3cc(Cl)c(Cl)cc3N2CCCCC)N(CCCC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C35H48Cl4N4/c1-5-9-13-20-42-32-24-28(38)26(36)22-30(32)40(18-11-7-3)34(42)16-15-17-35-41(19-12-8-4)31-23-27(37)29(39)25-33(31)43(35)21-14-10-6-2/h15-17,22-25,34H,5-14,18-21H2,1-4H3/b16-15+,35-17- |
| InChIKey | HIUJYADTHSESKZ-OFUOZZSGSA-N |
| XLogP | 11.96 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.61 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|