C25H19F3N2O4 — CID 171349399
3-[1-ethyl-2,4-dioxo-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepin-3-yl]benzoic acid (PubChem CID 171349399) has the molecular formula C25H19F3N2O4 and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-[1-ethyl-2,4-dioxo-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepin-3-yl]benzoic acid.
| Compound Name | 3-[1-ethyl-2,4-dioxo-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 171349399 |
| Molecular Formula | C25H19F3N2O4 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-[1-ethyl-2,4-dioxo-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepin-3-yl]benzoic acid |
| SMILES | CCN1C(=O)C(c2cccc(C(=O)O)c2)C(=O)N(c2ccccc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H19F3N2O4/c1-2-29-19-12-11-17(25(26,27)28)14-20(19)30(18-9-4-3-5-10-18)23(32)21(22(29)31)15-7-6-8-16(13-15)24(33)34/h3-14,21H,2H2,1H3,(H,33,34) |
| InChIKey | QFZWUFWLRKSIGL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|