C20H22F2N6O3S — CID 171349481
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(1-methylimidazol-2-yl)sulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine (PubChem CID 171349481) has the molecular formula C20H22F2N6O3S and a molecular weight of 464.50 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(1-methylimidazol-2-yl)sulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(1-methylimidazol-2-yl)sulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 171349481 |
| Molecular Formula | C20H22F2N6O3S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(1-methylimidazol-2-yl)sulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine |
| SMILES | Cn1ccnc1S(=O)(=O)n1ncc2c1CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C20H22F2N6O3S/c1-26-5-4-24-20(26)32(29,30)28-18-10-27(9-12(18)8-25-28)14-7-17(23)19(31-11-14)15-6-13(21)2-3-16(15)22/h2-6,8,14,17,19H,7,9-11,23H2,1H3/t14-,17+,19-/m1/s1 |
| InChIKey | JZICYJBHKSJXED-DKSSEZFCSA-N |
| XLogP | 1.30 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |