C27H24N6S — CID 171349483
N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 171349483) has the molecular formula C27H24N6S and a molecular weight of 464.60 g/mol. Its IUPAC name is N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171349483 |
| Molecular Formula | C27H24N6S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Cc1c(/N=C/c2ccccc2)/c(=N\Nc2nc(-c3ccccc3)cs2)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H24N6S/c1-20-25(28-18-21-12-6-3-7-13-21)26(33(32(20)2)23-16-10-5-11-17-23)30-31-27-29-24(19-34-27)22-14-8-4-9-15-22/h3-19H,1-2H3,(H,29,31)/b28-18+,30-26+ |
| InChIKey | YPDPDLHUQDNRLY-UROKKCKISA-N |
| XLogP | 5.93 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|