C30H22N4O2+2 — CID 171349600
6-amino-2-[3-(7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaen-4-yl)phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 171349600) has the molecular formula C30H22N4O2+2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 6-amino-2-[3-(7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaen-4-yl)phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-amino-2-[3-(7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaen-4-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 171349600 |
| Molecular Formula | C30H22N4O2+2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 6-amino-2-[3-(7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaen-4-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1ccc2c3c(cccc13)C(=O)N(c1cccc(-c3cc[n+]4c(c3)-c3cccc[n+]3CC4)c1)C2=O |
| InChI | InChI=1S/C30H21N4O2/c31-25-11-10-24-28-22(25)7-4-8-23(28)29(35)34(30(24)36)21-6-3-5-19(17-21)20-12-14-33-16-15-32-13-2-1-9-26(32)27(33)18-20/h1-14,17-18H,15-16H2,(H-,31,35,36)/q+1/p+1 |
| InChIKey | QSQRIDXCGINQTK-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|