C28H46O5 — CID 171349903
[(E,6S,7R)-6-hydroxy-7-(hydroxymethyl)-2,6-dimethylnon-3-en-2-yl] 2-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate (PubChem CID 171349903) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is [(E,6S,7R)-6-hydroxy-7-(hydroxymethyl)-2,6-dimethylnon-3-en-2-yl] 2-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate.
| Compound Name | [(E,6S,7R)-6-hydroxy-7-(hydroxymethyl)-2,6-dimethylnon-3-en-2-yl] 2-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate |
|---|---|
| PubChem CID | 171349903 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [(E,6S,7R)-6-hydroxy-7-(hydroxymethyl)-2,6-dimethylnon-3-en-2-yl] 2-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]acetate |
| SMILES | CC[C@H](CO)[C@@](C)(O)C/C=C/C(C)(C)OC(=O)C[C@]1(C)C=CC[C@@H](C)[C@@]12C=CC(C)(CC)O2 |
| InChI | InChI=1S/C28H46O5/c1-9-22(20-29)27(8,31)16-12-14-24(4,5)32-23(30)19-25(6)15-11-13-21(3)28(25)18-17-26(7,10-2)33-28/h11-12,14-15,17-18,21-22,29,31H,9-10,13,16,19-20H2,1-8H3/b14-12+/t21-,22-,25+,26?,27+,28+/m1/s1 |
| InChIKey | NVMRJIQSYMCXBY-HJUUDFSISA-N |
| XLogP | 5.51 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|