C46H64N4O6 — CID 171349950
3,3-bis[5-tert-butyl-2-(2-morpholin-4-ylethoxy)phenyl]-1-(2-morpholin-4-ylethyl)indol-2-one (PubChem CID 171349950) has the molecular formula C46H64N4O6 and a molecular weight of 769.04 g/mol. Its IUPAC name is 3,3-bis[5-tert-butyl-2-(2-morpholin-4-ylethoxy)phenyl]-1-(2-morpholin-4-ylethyl)indol-2-one.
| Compound Name | 3,3-bis[5-tert-butyl-2-(2-morpholin-4-ylethoxy)phenyl]-1-(2-morpholin-4-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 171349950 |
| Molecular Formula | C46H64N4O6 |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.48 |
| IUPAC Name | 3,3-bis[5-tert-butyl-2-(2-morpholin-4-ylethoxy)phenyl]-1-(2-morpholin-4-ylethyl)indol-2-one |
| SMILES | CC(C)(C)c1ccc(OCCN2CCOCC2)c(C2(c3cc(C(C)(C)C)ccc3OCCN3CCOCC3)C(=O)N(CCN3CCOCC3)c3ccccc32)c1 |
| InChI | InChI=1S/C46H64N4O6/c1-44(2,3)35-11-13-41(55-31-23-48-19-27-53-28-20-48)38(33-35)46(37-9-7-8-10-40(37)50(43(46)51)16-15-47-17-25-52-26-18-47)39-34-36(45(4,5)6)12-14-42(39)56-32-24-49-21-29-54-30-22-49/h7-14,33-34H,15-32H2,1-6H3 |
| InChIKey | RLKPRNKOOKXORF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 76.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |