C17H21N5O5S — CID 171350047
N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-2-methylpropanamide (PubChem CID 171350047) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-2-methylpropanamide.
| Compound Name | N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 171350047 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]-2-methylpropanamide |
| SMILES | COCC(NC(=O)C(C)C)C(=O)Nc1nnc(Cc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C17H21N5O5S/c1-10(2)15(23)18-13(9-27-3)16(24)19-17-21-20-14(28-17)8-11-4-6-12(7-5-11)22(25)26/h4-7,10,13H,8-9H2,1-3H3,(H,18,23)(H,19,21,24) |
| InChIKey | IJTNSOILMGGGCG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|