C19H22FN3O5S — CID 171350116
ethyl 2-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-4-[2-(2-fluoroethoxy)ethoxy]-1,3-thiazole-5-carboxylate (PubChem CID 171350116) has the molecular formula C19H22FN3O5S and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 2-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-4-[2-(2-fluoroethoxy)ethoxy]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-4-[2-(2-fluoroethoxy)ethoxy]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 171350116 |
| Molecular Formula | C19H22FN3O5S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethyl 2-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-4-[2-(2-fluoroethoxy)ethoxy]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccnc(NC(=O)C3CC3)c2)nc1OCCOCCF |
| InChI | InChI=1S/C19H22FN3O5S/c1-2-27-19(25)15-17(28-10-9-26-8-6-20)23-18(29-15)13-5-7-21-14(11-13)22-16(24)12-3-4-12/h5,7,11-12H,2-4,6,8-10H2,1H3,(H,21,22,24) |
| InChIKey | JFUWYYHZWKPKEN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|