C23H19N5O3 — CID 171350157
N-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-4-methoxybenzamide (PubChem CID 171350157) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-4-methoxybenzamide.
| Compound Name | N-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 171350157 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(NC(=O)c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N5O3/c1-31-19-14-12-17(13-15-19)21(30)25-23-26-22(24-20(29)16-8-4-2-5-9-16)27-28(23)18-10-6-3-7-11-18/h2-15H,1H3,(H2,24,25,26,27,29,30) |
| InChIKey | MYEJFECSKROJSO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |