About N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide
N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide (PubChem CID 171350283) has the molecular formula C23H17F2N3O3
and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide |
| PubChem CID | 171350283 |
| Molecular Formula | C23H17F2N3O3 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2ccc3[nH]c(=O)c(C)nc3c2)c1 |
| InChI | InChI=1S/C23H17F2N3O3/c1-12-23(30)28-19-6-3-14(9-20(19)26-12)17-11-16(27-13(2)29)5-8-21(17)31-22-7-4-15(24)10-18(22)25/h3-11H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | SCWAFDGYHNYXCI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide?
The IUPAC name of N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide (CID 171350283) is N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide is CC(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2ccc3[nH]c(=O)c(C)nc3c2)c1.
What is the InChIKey of N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide?
The InChIKey is SCWAFDGYHNYXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N3O3/c1-12-23(30)28-19-6-3-14(9-20(19)26-12)17-11-16(27-13(2)29)5-8-21(17)31-22-7-4-15(24)10-18(22)25/h3-11H,1-2H3,(H,27,29)(H,28,30).
What are the key properties of N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide?
N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide has a molecular weight of 421.40 g/mol, XLogP of 4.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4-difluorophenoxy)-3-(3-methyl-2-oxo-1H-quinoxalin-6-yl)phenyl]acetamide is sourced from PubChem (CID 171350283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).