C30H19N3O7 — CID 171350332
2-[3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-(methylamino)phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 171350332) has the molecular formula C30H19N3O7 and a molecular weight of 533.50 g/mol. Its IUPAC name is 2-[3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-(methylamino)phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-(methylamino)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 171350332 |
| Molecular Formula | C30H19N3O7 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 2-[3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-(methylamino)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CNc1ccc(N2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1-c1nc2cc(-c3ccc4c(c3)OCO4)ccc2o1 |
| InChI | InChI=1S/C30H19N3O7/c1-31-22-7-5-18(33-28(34)19-6-2-17(30(36)37)10-20(19)29(33)35)13-21(22)27-32-23-11-15(3-8-24(23)40-27)16-4-9-25-26(12-16)39-14-38-25/h2-13,31H,14H2,1H3,(H,36,37) |
| InChIKey | VHFHBWPQUVXBPG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|