About 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine
1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine (PubChem CID 171350366) has the molecular formula C19H18Cl2N2
and a molecular weight of 345.27 g/mol. Its IUPAC name is 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine |
| PubChem CID | 171350366 |
| Molecular Formula | C19H18Cl2N2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C19H18Cl2N2/c1-13-15(12-22-2)11-19(14-3-5-16(20)6-4-14)23(13)18-9-7-17(21)8-10-18/h3-11,22H,12H2,1-2H3 |
| InChIKey | NBKOQNMLSBJJOJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine?
The IUPAC name of 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine (CID 171350366) is 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine?
The canonical SMILES for 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine is CNCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)c1C.
What is the InChIKey of 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine?
The InChIKey is NBKOQNMLSBJJOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2N2/c1-13-15(12-22-2)11-19(14-3-5-16(20)6-4-14)23(13)18-9-7-17(21)8-10-18/h3-11,22H,12H2,1-2H3.
What are the key properties of 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine?
1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine has a molecular weight of 345.27 g/mol, XLogP of 5.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]-N-methylmethanamine is sourced from PubChem (CID 171350366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).