C33H40N2O2 — CID 171350444
(1R,2S,4R,5S,9S,12S,13S,18S)-5-(4-methoxyphenyl)-9,13-dimethyl-6-phenyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-one (PubChem CID 171350444) has the molecular formula C33H40N2O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is (1R,2S,4R,5S,9S,12S,13S,18S)-5-(4-methoxyphenyl)-9,13-dimethyl-6-phenyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-one.
| Compound Name | (1R,2S,4R,5S,9S,12S,13S,18S)-5-(4-methoxyphenyl)-9,13-dimethyl-6-phenyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-one |
|---|---|
| PubChem CID | 171350444 |
| Molecular Formula | C33H40N2O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | (1R,2S,4R,5S,9S,12S,13S,18S)-5-(4-methoxyphenyl)-9,13-dimethyl-6-phenyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-en-16-one |
| SMILES | COc1ccc([C@@H]2[C@H]3C[C@H]4[C@@H]5CC[C@H]6CC(=O)CC[C@]6(C)[C@H]5CC[C@]4(C)C3=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40N2O2/c1-32-17-15-24(36)19-22(32)11-14-26-28(32)16-18-33(2)29(26)20-27-30(21-9-12-25(37-3)13-10-21)35(34-31(27)33)23-7-5-4-6-8-23/h4-10,12-13,22,26-30H,11,14-20H2,1-3H3/t22-,26+,27+,28-,29-,30+,32-,33-/m0/s1 |
| InChIKey | BVAFKEYBCKSUCA-AXKKTUBASA-N |
| XLogP | 7.45 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |