About 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione
8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione (PubChem CID 171350617) has the molecular formula C19H26N6O4S
and a molecular weight of 434.52 g/mol. Its IUPAC name is 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione.
Molecular Properties
| Compound Name | 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
| PubChem CID | 171350617 |
| Molecular Formula | C19H26N6O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
| SMILES | O=c1[nH]c2cnc(NC3CCN(S(=O)(=O)C4CC4)CC3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C19H26N6O4S/c26-17-18(27)25(13-3-1-2-4-13)16-15(22-17)11-20-19(23-16)21-12-7-9-24(10-8-12)30(28,29)14-5-6-14/h11-14H,1-10H2,(H,22,26)(H,20,21,23) |
| InChIKey | GGTQMXJCGWRCMD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione?
The IUPAC name of 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione (CID 171350617) is 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione.
What is the SMILES notation for 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione?
The canonical SMILES for 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione is O=c1[nH]c2cnc(NC3CCN(S(=O)(=O)C4CC4)CC3)nc2n(C2CCCC2)c1=O.
What is the InChIKey of 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione?
The InChIKey is GGTQMXJCGWRCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N6O4S/c26-17-18(27)25(13-3-1-2-4-13)16-15(22-17)11-20-19(23-16)21-12-7-9-24(10-8-12)30(28,29)14-5-6-14/h11-14H,1-10H2,(H,22,26)(H,20,21,23).
What are the key properties of 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione?
8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione has a molecular weight of 434.52 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyl-2-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione is sourced from PubChem (CID 171350617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).