C25H21N3O3 — CID 171350620
1'-benzylspiro[3a,5,10,10a-tetrahydro-1H-furo[3,4-c][1,5]benzodiazepine-4,3'-indole]-2',3-dione (PubChem CID 171350620) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1'-benzylspiro[3a,5,10,10a-tetrahydro-1H-furo[3,4-c][1,5]benzodiazepine-4,3'-indole]-2',3-dione.
| Compound Name | 1'-benzylspiro[3a,5,10,10a-tetrahydro-1H-furo[3,4-c][1,5]benzodiazepine-4,3'-indole]-2',3-dione |
|---|---|
| PubChem CID | 171350620 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1'-benzylspiro[3a,5,10,10a-tetrahydro-1H-furo[3,4-c][1,5]benzodiazepine-4,3'-indole]-2',3-dione |
| SMILES | O=C1OCC2Nc3ccccc3NC3(C(=O)N(Cc4ccccc4)c4ccccc43)C12 |
| InChI | InChI=1S/C25H21N3O3/c29-23-22-20(15-31-23)26-18-11-5-6-12-19(18)27-25(22)17-10-4-7-13-21(17)28(24(25)30)14-16-8-2-1-3-9-16/h1-13,20,22,26-27H,14-15H2 |
| InChIKey | OPCNHFPTDWMDGP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |