C21H20ClFN2O3 — CID 171350681
2-fluoroethyl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 171350681) has the molecular formula C21H20ClFN2O3 and a molecular weight of 402.85 g/mol. Its IUPAC name is 2-fluoroethyl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | 2-fluoroethyl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 171350681 |
| Molecular Formula | C21H20ClFN2O3 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-fluoroethyl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)OCCF)cc1 |
| InChI | InChI=1S/C21H20ClFN2O3/c1-27-15-5-2-13(3-6-15)20-19-16(8-10-25(20)21(26)28-11-9-23)17-12-14(22)4-7-18(17)24-19/h2-7,12,20,24H,8-11H2,1H3 |
| InChIKey | CCQWAQUIVILAFP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|