C20H22N4O4S — CID 171350707
(2S)-2-[(2,3-dihydroxyphenyl)methylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid (PubChem CID 171350707) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is (2S)-2-[(2,3-dihydroxyphenyl)methylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid.
| Compound Name | (2S)-2-[(2,3-dihydroxyphenyl)methylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 171350707 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2S)-2-[(2,3-dihydroxyphenyl)methylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
| SMILES | O=C(O)[C@H](CCCn1c(-c2ccccc2)n[nH]c1=S)NCc1cccc(O)c1O |
| InChI | InChI=1S/C20H22N4O4S/c25-16-10-4-8-14(17(16)26)12-21-15(19(27)28)9-5-11-24-18(22-23-20(24)29)13-6-2-1-3-7-13/h1-4,6-8,10,15,21,25-26H,5,9,11-12H2,(H,23,29)(H,27,28)/t15-/m0/s1 |
| InChIKey | VQJOTZWLUMMOGR-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|