C29H29N7S — CID 171350727
N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine (PubChem CID 171350727) has the molecular formula C29H29N7S and a molecular weight of 507.67 g/mol. Its IUPAC name is N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171350727 |
| Molecular Formula | C29H29N7S |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[(E)-[4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine |
| SMILES | Cc1c(/N=C/c2ccccc2)/c(=N\Nc2nc(-c3ccc(N(C)C)cc3)cs2)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H29N7S/c1-21-27(30-19-22-11-7-5-8-12-22)28(36(35(21)4)25-13-9-6-10-14-25)32-33-29-31-26(20-37-29)23-15-17-24(18-16-23)34(2)3/h5-20H,1-4H3,(H,31,33)/b30-19+,32-28+ |
| InChIKey | HKOCKICYKNOIGQ-MQAOFYAHSA-N |
| XLogP | 5.99 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|