About [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate
[(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate (PubChem CID 171350908) has the molecular formula C20H27N3O5
and a molecular weight of 389.45 g/mol. Its IUPAC name is [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate |
| PubChem CID | 171350908 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate |
| SMILES | O=C(OC[C@H]1CN(c2ccc(N3CCOCC3)nc2)C(=O)O1)C1CCCCC1 |
| InChI | InChI=1S/C20H27N3O5/c24-19(15-4-2-1-3-5-15)27-14-17-13-23(20(25)28-17)16-6-7-18(21-12-16)22-8-10-26-11-9-22/h6-7,12,15,17H,1-5,8-11,13-14H2/t17-/m1/s1 |
| InChIKey | ZDGQOYRDRWYUHP-QGZVFWFLSA-N |
| XLogP | 2.37 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate?
The IUPAC name of [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate (CID 171350908) is [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate.
What is the SMILES notation for [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate?
The canonical SMILES for [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate is O=C(OC[C@H]1CN(c2ccc(N3CCOCC3)nc2)C(=O)O1)C1CCCCC1.
What is the InChIKey of [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate?
The InChIKey is ZDGQOYRDRWYUHP-QGZVFWFLSA-N. The full InChI is InChI=1S/C20H27N3O5/c24-19(15-4-2-1-3-5-15)27-14-17-13-23(20(25)28-17)16-6-7-18(21-12-16)22-8-10-26-11-9-22/h6-7,12,15,17H,1-5,8-11,13-14H2/t17-/m1/s1.
What are the key properties of [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate?
[(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate has a molecular weight of 389.45 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-3-(6-morpholin-4-yl-3-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl cyclohexanecarboxylate is sourced from PubChem (CID 171350908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).