C21H26N4O6 — CID 171350936
(2S)-3-methyl-2-[[2-[[1-[2-oxo-2-(prop-2-enoxyamino)ethyl]indole-3-carbonyl]amino]acetyl]amino]butanoic acid (PubChem CID 171350936) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-[[1-[2-oxo-2-(prop-2-enoxyamino)ethyl]indole-3-carbonyl]amino]acetyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-[[1-[2-oxo-2-(prop-2-enoxyamino)ethyl]indole-3-carbonyl]amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171350936 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (2S)-3-methyl-2-[[2-[[1-[2-oxo-2-(prop-2-enoxyamino)ethyl]indole-3-carbonyl]amino]acetyl]amino]butanoic acid |
| SMILES | C=CCONC(=O)Cn1cc(C(=O)NCC(=O)N[C@H](C(=O)O)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H26N4O6/c1-4-9-31-24-18(27)12-25-11-15(14-7-5-6-8-16(14)25)20(28)22-10-17(26)23-19(13(2)3)21(29)30/h4-8,11,13,19H,1,9-10,12H2,2-3H3,(H,22,28)(H,23,26)(H,24,27)(H,29,30)/t19-/m0/s1 |
| InChIKey | WUCWXOCBHYXYIO-IBGZPJMESA-N |
| XLogP | 0.83 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|