C28H23Cl2N3O5 — CID 171350964
3-[[(E)-1-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-pyridinyl]ethylideneamino]oxymethyl]benzoic acid (PubChem CID 171350964) has the molecular formula C28H23Cl2N3O5 and a molecular weight of 552.41 g/mol. Its IUPAC name is 3-[[(E)-1-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-pyridinyl]ethylideneamino]oxymethyl]benzoic acid.
| Compound Name | 3-[[(E)-1-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-pyridinyl]ethylideneamino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 171350964 |
| Molecular Formula | C28H23Cl2N3O5 |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 3-[[(E)-1-[5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-pyridinyl]ethylideneamino]oxymethyl]benzoic acid |
| SMILES | C/C(=N\OCc1cccc(C(=O)O)c1)c1ccc(OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cn1 |
| InChI | InChI=1S/C28H23Cl2N3O5/c1-16(32-37-14-17-4-2-5-19(12-17)28(34)35)24-11-10-20(13-31-24)36-15-21-26(33-38-27(21)18-8-9-18)25-22(29)6-3-7-23(25)30/h2-7,10-13,18H,8-9,14-15H2,1H3,(H,34,35)/b32-16+ |
| InChIKey | HNAAVQVJCXDKHM-KPGMTVGESA-N |
| XLogP | 7.14 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|