About methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate
methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate (PubChem CID 171350969) has the molecular formula C16H11N3O4S
and a molecular weight of 341.35 g/mol. Its IUPAC name is methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate.
Molecular Properties
| Compound Name | methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate |
| PubChem CID | 171350969 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate |
| SMILES | COC(=O)c1cc(C#N)cc(NC2=NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C16H11N3O4S/c1-23-16(20)11-6-10(9-17)7-12(8-11)18-15-13-4-2-3-5-14(13)24(21,22)19-15/h2-8H,1H3,(H,18,19) |
| InChIKey | ZKNODSLYWSGQLJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate?
The IUPAC name of methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate (CID 171350969) is methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate.
What is the SMILES notation for methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate?
The canonical SMILES for methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate is COC(=O)c1cc(C#N)cc(NC2=NS(=O)(=O)c3ccccc32)c1.
What is the InChIKey of methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate?
The InChIKey is ZKNODSLYWSGQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O4S/c1-23-16(20)11-6-10(9-17)7-12(8-11)18-15-13-4-2-3-5-14(13)24(21,22)19-15/h2-8H,1H3,(H,18,19).
What are the key properties of methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate?
methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate has a molecular weight of 341.35 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-5-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate is sourced from PubChem (CID 171350969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).