C23H38O4 — CID 171351206
[(3S)-3-hydroxyhexyl] 3-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]propanoate (PubChem CID 171351206) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is [(3S)-3-hydroxyhexyl] 3-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]propanoate.
| Compound Name | [(3S)-3-hydroxyhexyl] 3-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]propanoate |
|---|---|
| PubChem CID | 171351206 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | [(3S)-3-hydroxyhexyl] 3-[(5R,6R,10R)-2-ethyl-2,6,10-trimethyl-1-oxaspiro[4.5]deca-3,7-dien-6-yl]propanoate |
| SMILES | CCC[C@H](O)CCOC(=O)CC[C@]1(C)C=CC[C@@H](C)[C@@]12C=CC(C)(CC)O2 |
| InChI | InChI=1S/C23H38O4/c1-6-9-19(24)12-17-26-20(25)11-14-21(4)13-8-10-18(3)23(21)16-15-22(5,7-2)27-23/h8,13,15-16,18-19,24H,6-7,9-12,14,17H2,1-5H3/t18-,19+,21+,22?,23+/m1/s1 |
| InChIKey | XSCKNDBYCFZPBU-OZRCOERDSA-N |
| XLogP | 4.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|