C17H14O2S — CID 171351422
1-(1-benzothiophen-2-yl)-5,6,7,8-tetrahydroisochromen-3-one (PubChem CID 171351422) has the molecular formula C17H14O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-5,6,7,8-tetrahydroisochromen-3-one.
| Compound Name | 1-(1-benzothiophen-2-yl)-5,6,7,8-tetrahydroisochromen-3-one |
|---|---|
| PubChem CID | 171351422 |
| Molecular Formula | C17H14O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-5,6,7,8-tetrahydroisochromen-3-one |
| SMILES | O=c1cc2c(c(-c3cc4ccccc4s3)o1)CCCC2 |
| InChI | InChI=1S/C17H14O2S/c18-16-10-11-5-1-3-7-13(11)17(19-16)15-9-12-6-2-4-8-14(12)20-15/h2,4,6,8-10H,1,3,5,7H2 |
| InChIKey | SYHZPACWWQWUOH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |