C26H33FN2O9 — CID 171351651
2-O',3-O'-diethyl 5-O'-methyl (2'R,3'R)-1-butyl-5-fluoro-5'-(2-methoxy-2-oxoethyl)-2-oxospiro[indole-3,4'-pyrrolidine]-2',3',5'-tricarboxylate (PubChem CID 171351651) has the molecular formula C26H33FN2O9 and a molecular weight of 536.55 g/mol. Its IUPAC name is 2-O',3-O'-diethyl 5-O'-methyl (2'R,3'R)-1-butyl-5-fluoro-5'-(2-methoxy-2-oxoethyl)-2-oxospiro[indole-3,4'-pyrrolidine]-2',3',5'-tricarboxylate.
| Compound Name | 2-O',3-O'-diethyl 5-O'-methyl (2'R,3'R)-1-butyl-5-fluoro-5'-(2-methoxy-2-oxoethyl)-2-oxospiro[indole-3,4'-pyrrolidine]-2',3',5'-tricarboxylate |
|---|---|
| PubChem CID | 171351651 |
| Molecular Formula | C26H33FN2O9 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-O',3-O'-diethyl 5-O'-methyl (2'R,3'R)-1-butyl-5-fluoro-5'-(2-methoxy-2-oxoethyl)-2-oxospiro[indole-3,4'-pyrrolidine]-2',3',5'-tricarboxylate |
| SMILES | CCCCN1C(=O)C2(c3cc(F)ccc31)[C@@H](C(=O)OCC)[C@H](C(=O)OCC)NC2(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C26H33FN2O9/c1-6-9-12-29-17-11-10-15(27)13-16(17)26(23(29)33)19(21(31)37-7-2)20(22(32)38-8-3)28-25(26,24(34)36-5)14-18(30)35-4/h10-11,13,19-20,28H,6-9,12,14H2,1-5H3/t19-,20-,25?,26?/m1/s1 |
| InChIKey | PFBFCZPOJLYHRB-WSQGFLFRSA-N |
| XLogP | 1.40 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|