About 6-chloro-2,3,5-trimethylpyrimidin-4-one
6-chloro-2,3,5-trimethylpyrimidin-4-one (PubChem CID 171351666) has the molecular formula C7H9ClN2O
and a molecular weight of 172.61 g/mol. Its IUPAC name is 6-chloro-2,3,5-trimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2,3,5-trimethylpyrimidin-4-one |
| PubChem CID | 171351666 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 6-chloro-2,3,5-trimethylpyrimidin-4-one |
| SMILES | Cc1c(Cl)nc(C)n(C)c1=O |
| InChI | InChI=1S/C7H9ClN2O/c1-4-6(8)9-5(2)10(3)7(4)11/h1-3H3 |
| InChIKey | SRUSTJUEQQYMLE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2,3,5-trimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3,5-trimethylpyrimidin-4-one?
The IUPAC name of 6-chloro-2,3,5-trimethylpyrimidin-4-one (CID 171351666) is 6-chloro-2,3,5-trimethylpyrimidin-4-one.
What is the SMILES notation for 6-chloro-2,3,5-trimethylpyrimidin-4-one?
The canonical SMILES for 6-chloro-2,3,5-trimethylpyrimidin-4-one is Cc1c(Cl)nc(C)n(C)c1=O.
What is the InChIKey of 6-chloro-2,3,5-trimethylpyrimidin-4-one?
The InChIKey is SRUSTJUEQQYMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-4-6(8)9-5(2)10(3)7(4)11/h1-3H3.
What are the key properties of 6-chloro-2,3,5-trimethylpyrimidin-4-one?
6-chloro-2,3,5-trimethylpyrimidin-4-one has a molecular weight of 172.61 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3,5-trimethylpyrimidin-4-one is sourced from PubChem (CID 171351666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).